C7H10F6N2O — CID 103371071
3,3,3-trifluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)propanimidamide (PubChem CID 103371071) has the molecular formula C7H10F6N2O and a molecular weight of 252.16 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)propanimidamide |
|---|---|
| PubChem CID | 103371071 |
| Molecular Formula | C7H10F6N2O |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3,3,3-trifluoro-2-(1,1,1-trifluoropropan-2-yloxymethyl)propanimidamide |
| SMILES | [H]/N=C(\N)C(COC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6N2O/c1-3(6(8,9)10)16-2-4(5(14)15)7(11,12)13/h3-4H,2H2,1H3,(H3,14,15) |
| InChIKey | HAJLXPYRVDCIBL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|