C21H40OSi — CID 10337114
tert-butyl-dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane (PubChem CID 10337114) has the molecular formula C21H40OSi and a molecular weight of 336.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane |
|---|---|
| PubChem CID | 10337114 |
| Molecular Formula | C21H40OSi |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40OSi/c1-18(2)12-10-13-19(3)14-11-15-20(4)16-17-22-23(8,9)21(5,6)7/h12,14,16H,10-11,13,15,17H2,1-9H3/b19-14+,20-16+ |
| InChIKey | LULLVSRMXIXPNO-XHGFWWIISA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|