About 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide
2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103371305) has the molecular formula C8H15F3N2OS
and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| PubChem CID | 103371305 |
| Molecular Formula | C8H15F3N2OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CCC(C)SCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2OS/c1-3-5(2)15-4-6(7(12)13-14)8(9,10)11/h5-6,14H,3-4H2,1-2H3,(H2,12,13) |
| InChIKey | ZOEUFDICHXCUES-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The IUPAC name of 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide (CID 103371305) is 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide.
What is the SMILES notation for 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The canonical SMILES for 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide is CCC(C)SCC(C(N)=NO)C(F)(F)F.
What is the InChIKey of 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The InChIKey is ZOEUFDICHXCUES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2OS/c1-3-5(2)15-4-6(7(12)13-14)8(9,10)11/h5-6,14H,3-4H2,1-2H3,(H2,12,13).
What are the key properties of 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide has a molecular weight of 244.28 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butan-2-ylsulfanylmethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide is sourced from PubChem (CID 103371305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).