C7H8F3N3OS2 — CID 103371330
3,3,3-trifluoro-N'-hydroxy-2-(1,3-thiazol-2-ylsulfanylmethyl)propanimidamide (PubChem CID 103371330) has the molecular formula C7H8F3N3OS2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-(1,3-thiazol-2-ylsulfanylmethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-(1,3-thiazol-2-ylsulfanylmethyl)propanimidamide |
|---|---|
| PubChem CID | 103371330 |
| Molecular Formula | C7H8F3N3OS2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-(1,3-thiazol-2-ylsulfanylmethyl)propanimidamide |
| SMILES | N/C(=N/O)C(CSc1nccs1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3OS2/c8-7(9,10)4(5(11)13-14)3-16-6-12-1-2-15-6/h1-2,4,14H,3H2,(H2,11,13) |
| InChIKey | RGQLDUOCLYMJGZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|