C8H15F3N2O2S — CID 103371360
3,3,3-trifluoro-N'-hydroxy-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]propanimidamide (PubChem CID 103371360) has the molecular formula C8H15F3N2O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]propanimidamide |
|---|---|
| PubChem CID | 103371360 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]propanimidamide |
| SMILES | CC(CO)CSCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2S/c1-5(2-14)3-16-4-6(7(12)13-15)8(9,10)11/h5-6,14-15H,2-4H2,1H3,(H2,12,13) |
| InChIKey | ZGBWCLSEVNNRNZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|