C7H10F3N5S — CID 103371396
3,3,3-trifluoro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]propanimidamide (PubChem CID 103371396) has the molecular formula C7H10F3N5S and a molecular weight of 253.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]propanimidamide |
|---|---|
| PubChem CID | 103371396 |
| Molecular Formula | C7H10F3N5S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CSc1nncn1C)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N5S/c1-15-3-13-14-6(15)16-2-4(5(11)12)7(8,9)10/h3-4H,2H2,1H3,(H3,11,12) |
| InChIKey | DFTNMRZZKTYYMU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|