C11H10F3N3OS — CID 103371399
2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3,3,3-trifluoropropanimidamide (PubChem CID 103371399) has the molecular formula C11H10F3N3OS and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103371399 |
| Molecular Formula | C11H10F3N3OS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanylmethyl)-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CSc1nc2ccccc2o1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3N3OS/c12-11(13,14)6(9(15)16)5-19-10-17-7-3-1-2-4-8(7)18-10/h1-4,6H,5H2,(H3,15,16) |
| InChIKey | JHCQJIZTNVJQHH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|