C8H9F3N2S2 — CID 103371409
3,3,3-trifluoro-2-(thiophen-2-ylsulfanylmethyl)propanimidamide (PubChem CID 103371409) has the molecular formula C8H9F3N2S2 and a molecular weight of 254.30 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(thiophen-2-ylsulfanylmethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-(thiophen-2-ylsulfanylmethyl)propanimidamide |
|---|---|
| PubChem CID | 103371409 |
| Molecular Formula | C8H9F3N2S2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3,3,3-trifluoro-2-(thiophen-2-ylsulfanylmethyl)propanimidamide |
| SMILES | [H]/N=C(\N)C(CSc1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2S2/c9-8(10,11)5(7(12)13)4-15-6-2-1-3-14-6/h1-3,5H,4H2,(H3,12,13) |
| InChIKey | HVPUNPYJBAOUMR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|