C9H9F3N6S — CID 103371434
3,3,3-trifluoro-2-(7H-purin-6-ylsulfanylmethyl)propanimidamide (PubChem CID 103371434) has the molecular formula C9H9F3N6S and a molecular weight of 290.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(7H-purin-6-ylsulfanylmethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-(7H-purin-6-ylsulfanylmethyl)propanimidamide |
|---|---|
| PubChem CID | 103371434 |
| Molecular Formula | C9H9F3N6S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3,3,3-trifluoro-2-(7H-purin-6-ylsulfanylmethyl)propanimidamide |
| SMILES | [H]/N=C(\N)C(CSc1ncnc2nc[nH]c12)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N6S/c10-9(11,12)4(6(13)14)1-19-8-5-7(16-2-15-5)17-3-18-8/h2-4H,1H2,(H3,13,14)(H,15,16,17,18) |
| InChIKey | DKGWBHZAAKEQSL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|