C11H11F3N2O — CID 103371827
2-[(4-amino-2-methylphenoxy)methyl]-3,3,3-trifluoropropanenitrile (PubChem CID 103371827) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 2-[(4-amino-2-methylphenoxy)methyl]-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-[(4-amino-2-methylphenoxy)methyl]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103371827 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[(4-amino-2-methylphenoxy)methyl]-3,3,3-trifluoropropanenitrile |
| SMILES | Cc1cc(N)ccc1OCC(C#N)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c1-7-4-9(16)2-3-10(7)17-6-8(5-15)11(12,13)14/h2-4,8H,6,16H2,1H3 |
| InChIKey | LEFUQXQZTWUHLK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|