C9H13F3N2O — CID 103372199
3,3,3-trifluoro-2-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]propanenitrile (PubChem CID 103372199) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]propanenitrile |
|---|---|
| PubChem CID | 103372199 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3,3,3-trifluoro-2-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]propanenitrile |
| SMILES | C=CCN(CCO)CC(C#N)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O/c1-2-3-14(4-5-15)7-8(6-13)9(10,11)12/h2,8,15H,1,3-5,7H2 |
| InChIKey | YKKTWFPLUUZGPI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|