C16H26N2O4Si — CID 10337229
(3S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,5,8-trione (PubChem CID 10337229) has the molecular formula C16H26N2O4Si and a molecular weight of 338.48 g/mol. Its IUPAC name is (3S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,5,8-trione.
| Compound Name | (3S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,5,8-trione |
|---|---|
| PubChem CID | 10337229 |
| Molecular Formula | C16H26N2O4Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,5,8-trione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H]2C(=O)N3CC(=O)C[C@H]3C(=O)N2C1 |
| InChI | InChI=1S/C16H26N2O4Si/c1-16(2,3)23(4,5)22-11-7-13-15(21)17-8-10(19)6-12(17)14(20)18(13)9-11/h11-13H,6-9H2,1-5H3/t11-,12-,13-/m0/s1 |
| InChIKey | QYEVSLSTYKRIJO-AVGNSLFASA-N |
| XLogP | 1.16 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|