C18H25ClO4 — CID 10337343
ethyl 7-(3-chloropropoxy)-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 10337343) has the molecular formula C18H25ClO4 and a molecular weight of 340.85 g/mol. Its IUPAC name is ethyl 7-(3-chloropropoxy)-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | ethyl 7-(3-chloropropoxy)-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 10337343 |
| Molecular Formula | C18H25ClO4 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl 7-(3-chloropropoxy)-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | CCCc1c(OCCCCl)ccc2c1OC(C(=O)OCC)CC2 |
| InChI | InChI=1S/C18H25ClO4/c1-3-6-14-15(22-12-5-11-19)9-7-13-8-10-16(23-17(13)14)18(20)21-4-2/h7,9,16H,3-6,8,10-12H2,1-2H3 |
| InChIKey | HRGWGIDZLNRQGJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|