C15H14N2O2S — CID 103373528
2-(1-benzothiophen-3-yl)-1-(6-methoxypyridazin-3-yl)ethanol (PubChem CID 103373528) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(6-methoxypyridazin-3-yl)ethanol.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(6-methoxypyridazin-3-yl)ethanol |
|---|---|
| PubChem CID | 103373528 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(6-methoxypyridazin-3-yl)ethanol |
| SMILES | COc1ccc(C(O)Cc2csc3ccccc23)nn1 |
| InChI | InChI=1S/C15H14N2O2S/c1-19-15-7-6-12(16-17-15)13(18)8-10-9-20-14-5-3-2-4-11(10)14/h2-7,9,13,18H,8H2,1H3 |
| InChIKey | IVKGJLOAHPJLDS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |