C10H12BrN5O — CID 103374008
(4-bromo-1-methylpyrazol-5-yl)-(6-methoxypyridazin-3-yl)methanamine (PubChem CID 103374008) has the molecular formula C10H12BrN5O and a molecular weight of 298.14 g/mol. Its IUPAC name is (4-bromo-1-methylpyrazol-5-yl)-(6-methoxypyridazin-3-yl)methanamine.
| Compound Name | (4-bromo-1-methylpyrazol-5-yl)-(6-methoxypyridazin-3-yl)methanamine |
|---|---|
| PubChem CID | 103374008 |
| Molecular Formula | C10H12BrN5O |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | (4-bromo-1-methylpyrazol-5-yl)-(6-methoxypyridazin-3-yl)methanamine |
| SMILES | COc1ccc(C(N)c2c(Br)cnn2C)nn1 |
| InChI | InChI=1S/C10H12BrN5O/c1-16-10(6(11)5-13-16)9(12)7-3-4-8(17-2)15-14-7/h3-5,9H,12H2,1-2H3 |
| InChIKey | RSPIDLAILVFYCN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |