About 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine
5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine (PubChem CID 10337498) has the molecular formula C20H17N5O
and a molecular weight of 343.39 g/mol. Its IUPAC name is 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine.
Molecular Properties
| Compound Name | 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine |
| PubChem CID | 10337498 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine |
| SMILES | Cn1ncnc1COc1cccc(-c2cnnc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H17N5O/c1-25-20(21-14-23-25)13-26-18-9-5-8-16(10-18)17-11-19(24-22-12-17)15-6-3-2-4-7-15/h2-12,14H,13H2,1H3 |
| InChIKey | PXCVVFWVLHUINV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine?
The IUPAC name of 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine (CID 10337498) is 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine.
What is the SMILES notation for 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine?
The canonical SMILES for 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine is Cn1ncnc1COc1cccc(-c2cnnc(-c3ccccc3)c2)c1.
What is the InChIKey of 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine?
The InChIKey is PXCVVFWVLHUINV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5O/c1-25-20(21-14-23-25)13-26-18-9-5-8-16(10-18)17-11-19(24-22-12-17)15-6-3-2-4-7-15/h2-12,14H,13H2,1H3.
What are the key properties of 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine?
5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine has a molecular weight of 343.39 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(2-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]-3-phenylpyridazine is sourced from PubChem (CID 10337498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).