C16H12N2OS3 — CID 10337585
(5Z)-3-methyl-5-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 10337585) has the molecular formula C16H12N2OS3 and a molecular weight of 344.49 g/mol. Its IUPAC name is (5Z)-3-methyl-5-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-methyl-5-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10337585 |
| Molecular Formula | C16H12N2OS3 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | (5Z)-3-methyl-5-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C2/Sc3ccc4ccccc4c3N2C)SC1=S |
| InChI | InChI=1S/C16H12N2OS3/c1-17-12-10-6-4-3-5-9(10)7-8-11(12)21-15(17)13-14(19)18(2)16(20)22-13/h3-8H,1-2H3/b15-13- |
| InChIKey | KNSPKXDJPVYNSV-SQFISAMPSA-N |
| XLogP | 4.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|