About 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile
2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile (PubChem CID 103375863) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile.
Analyze 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile?
The IUPAC name of 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile (CID 103375863) is 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile.
What is the SMILES notation for 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile?
The canonical SMILES for 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile is N#CC(OCCO)c1nccs1.
What is the InChIKey of 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile?
The InChIKey is ADRPGBJIHQGKRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c8-5-6(11-3-2-10)7-9-1-4-12-7/h1,4,6,10H,2-3H2.
What are the key properties of 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile?
2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile has a molecular weight of 184.22 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)-2-(1,3-thiazol-2-yl)acetonitrile is sourced from PubChem (CID 103375863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).