About 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile
2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile (PubChem CID 103376475) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile |
| PubChem CID | 103376475 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile |
| SMILES | COC(C)(C)CC(C)(C#N)OCCCO |
| InChI | InChI=1S/C11H21NO3/c1-10(2,14-4)8-11(3,9-12)15-7-5-6-13/h13H,5-8H2,1-4H3 |
| InChIKey | XVONLQPWFRJCAE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile?
The IUPAC name of 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile (CID 103376475) is 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile.
What is the SMILES notation for 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile?
The canonical SMILES for 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile is COC(C)(C)CC(C)(C#N)OCCCO.
What is the InChIKey of 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile?
The InChIKey is XVONLQPWFRJCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-10(2,14-4)8-11(3,9-12)15-7-5-6-13/h13H,5-8H2,1-4H3.
What are the key properties of 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile?
2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile has a molecular weight of 215.29 g/mol, XLogP of 1.48, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxypropoxy)-4-methoxy-2,4-dimethylpentanenitrile is sourced from PubChem (CID 103376475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).