C16H26O4S2 — CID 10337704
(4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(2S)-4,8-dithiaspiro[2.5]octan-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10337704) has the molecular formula C16H26O4S2 and a molecular weight of 346.51 g/mol. Its IUPAC name is (4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(2S)-4,8-dithiaspiro[2.5]octan-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(2S)-4,8-dithiaspiro[2.5]octan-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10337704 |
| Molecular Formula | C16H26O4S2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(2S)-4,8-dithiaspiro[2.5]octan-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H]([C@@H]2CC23SCCCS3)O1 |
| InChI | InChI=1S/C16H26O4S2/c1-14(2)17-9-11(18-14)13-12(19-15(3,4)20-13)10-8-16(10)21-6-5-7-22-16/h10-13H,5-9H2,1-4H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | MRANJLAVUQRLAC-UMSGYPCISA-N |
| XLogP | 3.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |