About 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol
3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol (PubChem CID 103377189) has the molecular formula C9H19NO4S
and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol.
Molecular Properties
| Compound Name | 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol |
| PubChem CID | 103377189 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol |
| SMILES | CC(O)C(C)OC1(CN)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19NO4S/c1-7(11)8(2)14-9(5-10)3-4-15(12,13)6-9/h7-8,11H,3-6,10H2,1-2H3 |
| InChIKey | MKDFKUOTYRSTDT-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol?
The IUPAC name of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol (CID 103377189) is 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol.
What is the SMILES notation for 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol?
The canonical SMILES for 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol is CC(O)C(C)OC1(CN)CCS(=O)(=O)C1.
What is the InChIKey of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol?
The InChIKey is MKDFKUOTYRSTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO4S/c1-7(11)8(2)14-9(5-10)3-4-15(12,13)6-9/h7-8,11H,3-6,10H2,1-2H3.
What are the key properties of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol?
3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol has a molecular weight of 237.32 g/mol, XLogP of -0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxybutan-2-ol is sourced from PubChem (CID 103377189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).