C10H18N2O2S — CID 103377235
3-[2-amino-1-(4-methyl-1,3-thiazol-2-yl)ethoxy]butan-2-ol (PubChem CID 103377235) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 3-[2-amino-1-(4-methyl-1,3-thiazol-2-yl)ethoxy]butan-2-ol.
| Compound Name | 3-[2-amino-1-(4-methyl-1,3-thiazol-2-yl)ethoxy]butan-2-ol |
|---|---|
| PubChem CID | 103377235 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-[2-amino-1-(4-methyl-1,3-thiazol-2-yl)ethoxy]butan-2-ol |
| SMILES | Cc1csc(C(CN)OC(C)C(C)O)n1 |
| InChI | InChI=1S/C10H18N2O2S/c1-6-5-15-10(12-6)9(4-11)14-8(3)7(2)13/h5,7-9,13H,4,11H2,1-3H3 |
| InChIKey | LXGQYBNTHLLDLG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |