C17H24F3NO3 — CID 10337731
[(2R)-2-aminoheptyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10337731) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is [(2R)-2-aminoheptyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R)-2-aminoheptyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10337731 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [(2R)-2-aminoheptyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCC[C@@H](N)COC(=O)C(OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H24F3NO3/c1-3-4-6-11-14(21)12-24-15(22)16(23-2,17(18,19)20)13-9-7-5-8-10-13/h5,7-10,14H,3-4,6,11-12,21H2,1-2H3/t14-,16?/m1/s1 |
| InChIKey | BGJGMDWNSNXCEG-IURRXHLWSA-N |
| XLogP | 3.54 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|