About 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol
3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol (PubChem CID 103377469) has the molecular formula C8H17NO4S
and a molecular weight of 223.29 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol.
Molecular Properties
| Compound Name | 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol |
| PubChem CID | 103377469 |
| Molecular Formula | C8H17NO4S |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol |
| SMILES | NCC1(OCCCO)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO4S/c9-6-8(13-4-1-3-10)2-5-14(11,12)7-8/h10H,1-7,9H2 |
| InChIKey | PYKGEVZHSNPSMK-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol?
The IUPAC name of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol (CID 103377469) is 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol.
What is the SMILES notation for 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol?
The canonical SMILES for 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol is NCC1(OCCCO)CCS(=O)(=O)C1.
What is the InChIKey of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol?
The InChIKey is PYKGEVZHSNPSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4S/c9-6-8(13-4-1-3-10)2-5-14(11,12)7-8/h10H,1-7,9H2.
What are the key properties of 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol?
3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol has a molecular weight of 223.29 g/mol, XLogP of -1.10, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]oxypropan-1-ol is sourced from PubChem (CID 103377469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).