C10H20O4 — CID 103377767
2-(3-hydroxybutan-2-yloxy)-2,3-dimethylbutanoic acid (PubChem CID 103377767) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(3-hydroxybutan-2-yloxy)-2,3-dimethylbutanoic acid.
| Compound Name | 2-(3-hydroxybutan-2-yloxy)-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103377767 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-(3-hydroxybutan-2-yloxy)-2,3-dimethylbutanoic acid |
| SMILES | CC(O)C(C)OC(C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C10H20O4/c1-6(2)10(5,9(12)13)14-8(4)7(3)11/h6-8,11H,1-5H3,(H,12,13) |
| InChIKey | IRTGMDVAMJFBTE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |