C13H18O4 — CID 103377988
2-(3-hydroxypropoxy)-2-methyl-3-phenylpropanoic acid (PubChem CID 103377988) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-(3-hydroxypropoxy)-2-methyl-3-phenylpropanoic acid.
| Compound Name | 2-(3-hydroxypropoxy)-2-methyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 103377988 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(3-hydroxypropoxy)-2-methyl-3-phenylpropanoic acid |
| SMILES | CC(Cc1ccccc1)(OCCCO)C(=O)O |
| InChI | InChI=1S/C13H18O4/c1-13(12(15)16,17-9-5-8-14)10-11-6-3-2-4-7-11/h2-4,6-7,14H,5,8-10H2,1H3,(H,15,16) |
| InChIKey | GSHNEKRQNZPHHD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|