About 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide
3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide (PubChem CID 103378262) has the molecular formula C11H14N6OS
and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide |
| PubChem CID | 103378262 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1c(N)nsc1NCc1ccnc(C)n1 |
| InChI | InChI=1S/C11H14N6OS/c1-6-14-4-3-7(16-6)5-15-11-8(10(18)13-2)9(12)17-19-11/h3-4,15H,5H2,1-2H3,(H2,12,17)(H,13,18) |
| InChIKey | MMASEXRCJBXIBQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide (CID 103378262) is 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide is CNC(=O)c1c(N)nsc1NCc1ccnc(C)n1.
What is the InChIKey of 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide?
The InChIKey is MMASEXRCJBXIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N6OS/c1-6-14-4-3-7(16-6)5-15-11-8(10(18)13-2)9(12)17-19-11/h3-4,15H,5H2,1-2H3,(H2,12,17)(H,13,18).
What are the key properties of 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide?
3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide has a molecular weight of 278.34 g/mol, XLogP of 0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-methyl-5-[(2-methylpyrimidin-4-yl)methylamino]-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 103378262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).