C12H21N5OS — CID 103380124
3-amino-N-methyl-5-(3-pyrrolidin-1-ylpropylamino)-1,2-thiazole-4-carboxamide (PubChem CID 103380124) has the molecular formula C12H21N5OS and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-amino-N-methyl-5-(3-pyrrolidin-1-ylpropylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-N-methyl-5-(3-pyrrolidin-1-ylpropylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103380124 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-amino-N-methyl-5-(3-pyrrolidin-1-ylpropylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1c(N)nsc1NCCCN1CCCC1 |
| InChI | InChI=1S/C12H21N5OS/c1-14-11(18)9-10(13)16-19-12(9)15-5-4-8-17-6-2-3-7-17/h15H,2-8H2,1H3,(H2,13,16)(H,14,18) |
| InChIKey | GPQCPODPILAELO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|