C12H22N4O3S — CID 103380390
3-amino-5-[2-methoxyethyl(3-methoxypropyl)amino]-N-methyl-1,2-thiazole-4-carboxamide (PubChem CID 103380390) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-amino-5-[2-methoxyethyl(3-methoxypropyl)amino]-N-methyl-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-[2-methoxyethyl(3-methoxypropyl)amino]-N-methyl-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103380390 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-amino-5-[2-methoxyethyl(3-methoxypropyl)amino]-N-methyl-1,2-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1c(N)nsc1N(CCCOC)CCOC |
| InChI | InChI=1S/C12H22N4O3S/c1-14-11(17)9-10(13)15-20-12(9)16(6-8-19-3)5-4-7-18-2/h4-8H2,1-3H3,(H2,13,15)(H,14,17) |
| InChIKey | KXDCZNNMGJNPIE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|