C10H15N5O2S — CID 103381005
5-(4-acetylpiperazin-1-yl)-3-amino-1,2-thiazole-4-carboxamide (PubChem CID 103381005) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-(4-acetylpiperazin-1-yl)-3-amino-1,2-thiazole-4-carboxamide.
| Compound Name | 5-(4-acetylpiperazin-1-yl)-3-amino-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103381005 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-(4-acetylpiperazin-1-yl)-3-amino-1,2-thiazole-4-carboxamide |
| SMILES | CC(=O)N1CCN(c2snc(N)c2C(N)=O)CC1 |
| InChI | InChI=1S/C10H15N5O2S/c1-6(16)14-2-4-15(5-3-14)10-7(9(12)17)8(11)13-18-10/h2-5H2,1H3,(H2,11,13)(H2,12,17) |
| InChIKey | DKQDPCOWXKQDPV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |