About 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide
3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide (PubChem CID 103381021) has the molecular formula C12H20N4OS
and a molecular weight of 268.39 g/mol. Its IUPAC name is 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide |
| PubChem CID | 103381021 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1c(N)nsc1N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C12H20N4OS/c1-7-4-8(2)6-16(5-7)12-9(11(17)14-3)10(13)15-18-12/h7-8H,4-6H2,1-3H3,(H2,13,15)(H,14,17) |
| InChIKey | CLTFJCLHDYSBPX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide (CID 103381021) is 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide is CNC(=O)c1c(N)nsc1N1CC(C)CC(C)C1.
What is the InChIKey of 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide?
The InChIKey is CLTFJCLHDYSBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4OS/c1-7-4-8(2)6-16(5-7)12-9(11(17)14-3)10(13)15-18-12/h7-8H,4-6H2,1-3H3,(H2,13,15)(H,14,17).
What are the key properties of 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide?
3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide has a molecular weight of 268.39 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(3,5-dimethylpiperidin-1-yl)-N-methyl-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 103381021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).