About 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine
5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine (PubChem CID 103381246) has the molecular formula C14H19N3S2
and a molecular weight of 293.46 g/mol. Its IUPAC name is 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine |
| PubChem CID | 103381246 |
| Molecular Formula | C14H19N3S2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine |
| SMILES | CSCC(C)CNc1snc(N)c1-c1ccccc1 |
| InChI | InChI=1S/C14H19N3S2/c1-10(9-18-2)8-16-14-12(13(15)17-19-14)11-6-4-3-5-7-11/h3-7,10,16H,8-9H2,1-2H3,(H2,15,17) |
| InChIKey | OJHCFTHHWDRBGX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine?
The IUPAC name of 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine (CID 103381246) is 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine?
The canonical SMILES for 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine is CSCC(C)CNc1snc(N)c1-c1ccccc1.
What is the InChIKey of 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine?
The InChIKey is OJHCFTHHWDRBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S2/c1-10(9-18-2)8-16-14-12(13(15)17-19-14)11-6-4-3-5-7-11/h3-7,10,16H,8-9H2,1-2H3,(H2,15,17).
What are the key properties of 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine?
5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine has a molecular weight of 293.46 g/mol, XLogP of 3.80, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2-methyl-3-methylsulfanylpropyl)-4-phenyl-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103381246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).