C12H18N4S — CID 103382060
3-amino-5-(4-ethylazepan-1-yl)-1,2-thiazole-4-carbonitrile (PubChem CID 103382060) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-amino-5-(4-ethylazepan-1-yl)-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-amino-5-(4-ethylazepan-1-yl)-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 103382060 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-amino-5-(4-ethylazepan-1-yl)-1,2-thiazole-4-carbonitrile |
| SMILES | CCC1CCCN(c2snc(N)c2C#N)CC1 |
| InChI | InChI=1S/C12H18N4S/c1-2-9-4-3-6-16(7-5-9)12-10(8-13)11(14)15-17-12/h9H,2-7H2,1H3,(H2,14,15) |
| InChIKey | QHGPMLIGSVPPPS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |