About 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride
6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride (PubChem CID 10338254) has the molecular formula C20H19ClN2O2
and a molecular weight of 354.84 g/mol. Its IUPAC name is 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride.
Molecular Properties
| Compound Name | 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride |
| PubChem CID | 10338254 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride |
| SMILES | Cl.NCCCCn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H18N2O2.ClH/c21-11-5-6-12-22-18-14-8-2-3-9-15(14)19(23)17(18)13-7-1-4-10-16(13)20(22)24;/h1-4,7-10H,5-6,11-12,21H2;1H |
| InChIKey | DPVMCOIVRZSKKX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride?
The IUPAC name of 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride (CID 10338254) is 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride.
What is the SMILES notation for 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride?
The canonical SMILES for 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride is Cl.NCCCCn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2.
What is the InChIKey of 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride?
The InChIKey is DPVMCOIVRZSKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2.ClH/c21-11-5-6-12-22-18-14-8-2-3-9-15(14)19(23)17(18)13-7-1-4-10-16(13)20(22)24;/h1-4,7-10H,5-6,11-12,21H2;1H.
What are the key properties of 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride?
6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride has a molecular weight of 354.84 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-aminobutyl)indeno[1,2-c]isoquinoline-5,11-dione;hydrochloride is sourced from PubChem (CID 10338254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).