About 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide
3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide (PubChem CID 103383143) has the molecular formula C10H18N4O3S2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide |
| PubChem CID | 103383143 |
| Molecular Formula | C10H18N4O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1c(N)nsc1NCCS(C)(=O)=O |
| InChI | InChI=1S/C10H18N4O3S2/c1-6(2)13-9(15)7-8(11)14-18-10(7)12-4-5-19(3,16)17/h6,12H,4-5H2,1-3H3,(H2,11,14)(H,13,15) |
| InChIKey | ZNOXMZVXMIYFID-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide (CID 103383143) is 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide is CC(C)NC(=O)c1c(N)nsc1NCCS(C)(=O)=O.
What is the InChIKey of 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide?
The InChIKey is ZNOXMZVXMIYFID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O3S2/c1-6(2)13-9(15)7-8(11)14-18-10(7)12-4-5-19(3,16)17/h6,12H,4-5H2,1-3H3,(H2,11,14)(H,13,15).
What are the key properties of 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide?
3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide has a molecular weight of 306.41 g/mol, XLogP of 0.32, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(2-methylsulfonylethylamino)-N-propan-2-yl-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 103383143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).