About 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide
3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide (PubChem CID 103383150) has the molecular formula C9H13N5OS
and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide |
| PubChem CID | 103383150 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNc1snc(N)c1C#N |
| InChI | InChI=1S/C9H13N5OS/c1-14(2)7(15)3-4-12-9-6(5-10)8(11)13-16-9/h12H,3-4H2,1-2H3,(H2,11,13) |
| InChIKey | UTNXJSRUHRUKDD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide?
The IUPAC name of 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide (CID 103383150) is 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide is CN(C)C(=O)CCNc1snc(N)c1C#N.
What is the InChIKey of 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide?
The InChIKey is UTNXJSRUHRUKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5OS/c1-14(2)7(15)3-4-12-9-6(5-10)8(11)13-16-9/h12H,3-4H2,1-2H3,(H2,11,13).
What are the key properties of 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide?
3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide has a molecular weight of 239.30 g/mol, XLogP of 0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-4-cyano-1,2-thiazol-5-yl)amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 103383150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).