About 3H-inden-1-ol;tris(propan-2-ol);titanium
3H-inden-1-ol;tris(propan-2-ol);titanium (PubChem CID 10338320) has the molecular formula C18H32O4Ti
and a molecular weight of 360.32 g/mol. Its IUPAC name is 3H-inden-1-ol;tris(propan-2-ol);titanium.
Molecular Properties
| Compound Name | 3H-inden-1-ol;tris(propan-2-ol);titanium |
| PubChem CID | 10338320 |
| Molecular Formula | C18H32O4Ti |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3H-inden-1-ol;tris(propan-2-ol);titanium |
| SMILES | CC(C)O.CC(C)O.CC(C)O.OC1=CCc2ccccc21.[Ti] |
| InChI | InChI=1S/C9H8O.3C3H8O.Ti/c10-9-6-5-7-3-1-2-4-8(7)9;3*1-3(2)4;/h1-4,6,10H,5H2;3*3-4H,1-2H3; |
| InChIKey | CRMVCWVTPNEFEZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3H-inden-1-ol;tris(propan-2-ol);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-inden-1-ol;tris(propan-2-ol);titanium?
The IUPAC name of 3H-inden-1-ol;tris(propan-2-ol);titanium (CID 10338320) is 3H-inden-1-ol;tris(propan-2-ol);titanium.
What is the SMILES notation for 3H-inden-1-ol;tris(propan-2-ol);titanium?
The canonical SMILES for 3H-inden-1-ol;tris(propan-2-ol);titanium is CC(C)O.CC(C)O.CC(C)O.OC1=CCc2ccccc21.[Ti].
What is the InChIKey of 3H-inden-1-ol;tris(propan-2-ol);titanium?
The InChIKey is CRMVCWVTPNEFEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.3C3H8O.Ti/c10-9-6-5-7-3-1-2-4-8(7)9;3*1-3(2)4;/h1-4,6,10H,5H2;3*3-4H,1-2H3;.
What are the key properties of 3H-inden-1-ol;tris(propan-2-ol);titanium?
3H-inden-1-ol;tris(propan-2-ol);titanium has a molecular weight of 360.32 g/mol, XLogP of 3.30, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-inden-1-ol;tris(propan-2-ol);titanium is sourced from PubChem (CID 10338320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).