About 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide
3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide (PubChem CID 103383507) has the molecular formula C12H15N5OS
and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide |
| PubChem CID | 103383507 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1cccc(CN(C)c2snc(N)c2C(N)=O)n1 |
| InChI | InChI=1S/C12H15N5OS/c1-7-4-3-5-8(15-7)6-17(2)12-9(11(14)18)10(13)16-19-12/h3-5H,6H2,1-2H3,(H2,13,16)(H2,14,18) |
| InChIKey | USCAZSXNIIXEAV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide (CID 103383507) is 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide is Cc1cccc(CN(C)c2snc(N)c2C(N)=O)n1.
What is the InChIKey of 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide?
The InChIKey is USCAZSXNIIXEAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5OS/c1-7-4-3-5-8(15-7)6-17(2)12-9(11(14)18)10(13)16-19-12/h3-5H,6H2,1-2H3,(H2,13,16)(H2,14,18).
What are the key properties of 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide?
3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide has a molecular weight of 277.35 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 103383507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).