C17H30N2O6 — CID 10338452
1,3-bis(2,2-diethoxyethyl)-5-methylpyrimidine-2,4-dione (PubChem CID 10338452) has the molecular formula C17H30N2O6 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1,3-bis(2,2-diethoxyethyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1,3-bis(2,2-diethoxyethyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10338452 |
| Molecular Formula | C17H30N2O6 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1,3-bis(2,2-diethoxyethyl)-5-methylpyrimidine-2,4-dione |
| SMILES | CCOC(Cn1cc(C)c(=O)n(CC(OCC)OCC)c1=O)OCC |
| InChI | InChI=1S/C17H30N2O6/c1-6-22-14(23-7-2)11-18-10-13(5)16(20)19(17(18)21)12-15(24-8-3)25-9-4/h10,14-15H,6-9,11-12H2,1-5H3 |
| InChIKey | XOKARPKKKGMEBF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|