About N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine
N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 103385634) has the molecular formula C15H14N4O
and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 103385634 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cn1cnc2c(NC3COc4ccccc43)nccc21 |
| InChI | InChI=1S/C15H14N4O/c1-19-9-17-14-12(19)6-7-16-15(14)18-11-8-20-13-5-3-2-4-10(11)13/h2-7,9,11H,8H2,1H3,(H,16,18) |
| InChIKey | CSQIVIFIGFCBSH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine?
The IUPAC name of N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine (CID 103385634) is N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine is Cn1cnc2c(NC3COc4ccccc43)nccc21.
What is the InChIKey of N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine?
The InChIKey is CSQIVIFIGFCBSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O/c1-19-9-17-14-12(19)6-7-16-15(14)18-11-8-20-13-5-3-2-4-10(11)13/h2-7,9,11H,8H2,1H3,(H,16,18).
What are the key properties of N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine?
N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine has a molecular weight of 266.30 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1-benzofuran-3-yl)-1-methylimidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 103385634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).