C22H32O4 — CID 10338589
[(1R,4S,6S,9Z,12S)-4,12-dimethyl-14-oxo-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-9-yl]methyl acetate (PubChem CID 10338589) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1R,4S,6S,9Z,12S)-4,12-dimethyl-14-oxo-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-9-yl]methyl acetate.
| Compound Name | [(1R,4S,6S,9Z,12S)-4,12-dimethyl-14-oxo-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-9-yl]methyl acetate |
|---|---|
| PubChem CID | 10338589 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1R,4S,6S,9Z,12S)-4,12-dimethyl-14-oxo-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-9-yl]methyl acetate |
| SMILES | CC(=O)OC/C1=C\C[C@@]2(C)CC(=O)C(=C(C)C)[C@@H]2CC[C@]2(C)O[C@H]2CC1 |
| InChI | InChI=1S/C22H32O4/c1-14(2)20-17-9-11-22(5)19(26-22)7-6-16(13-25-15(3)23)8-10-21(17,4)12-18(20)24/h8,17,19H,6-7,9-13H2,1-5H3/b16-8-/t17-,19-,21-,22-/m0/s1 |
| InChIKey | ZOSAKIHZJAHFSI-YVHXJDQRSA-N |
| XLogP | 4.53 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|