About N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine
N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine (PubChem CID 103386060) has the molecular formula C15H23N5
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine |
| PubChem CID | 103386060 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine |
| SMILES | CCNCC1CCN(c2nccc3c2ncn3C)CC1 |
| InChI | InChI=1S/C15H23N5/c1-3-16-10-12-5-8-20(9-6-12)15-14-13(4-7-17-15)19(2)11-18-14/h4,7,11-12,16H,3,5-6,8-10H2,1-2H3 |
| InChIKey | MSCDOOKRQFYYPQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine?
The IUPAC name of N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine (CID 103386060) is N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine.
What is the SMILES notation for N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine?
The canonical SMILES for N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine is CCNCC1CCN(c2nccc3c2ncn3C)CC1.
What is the InChIKey of N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine?
The InChIKey is MSCDOOKRQFYYPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N5/c1-3-16-10-12-5-8-20(9-6-12)15-14-13(4-7-17-15)19(2)11-18-14/h4,7,11-12,16H,3,5-6,8-10H2,1-2H3.
What are the key properties of N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine?
N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine has a molecular weight of 273.38 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-4-yl]methyl]ethanamine is sourced from PubChem (CID 103386060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).