About 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide
2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide (PubChem CID 103386257) has the molecular formula C9H12N4O2S2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide.
Molecular Properties
| Compound Name | 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide |
| PubChem CID | 103386257 |
| Molecular Formula | C9H12N4O2S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide |
| SMILES | Cn1cnc2c(SCCS(N)(=O)=O)nccc21 |
| InChI | InChI=1S/C9H12N4O2S2/c1-13-6-12-8-7(13)2-3-11-9(8)16-4-5-17(10,14)15/h2-3,6H,4-5H2,1H3,(H2,10,14,15) |
| InChIKey | BEQAOELKHYIYNY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide?
The IUPAC name of 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide (CID 103386257) is 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide.
What is the SMILES notation for 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide?
The canonical SMILES for 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide is Cn1cnc2c(SCCS(N)(=O)=O)nccc21.
What is the InChIKey of 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide?
The InChIKey is BEQAOELKHYIYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2S2/c1-13-6-12-8-7(13)2-3-11-9(8)16-4-5-17(10,14)15/h2-3,6H,4-5H2,1H3,(H2,10,14,15).
What are the key properties of 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide?
2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide has a molecular weight of 272.35 g/mol, XLogP of 0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylimidazo[4,5-c]pyridin-4-yl)sulfanylethanesulfonamide is sourced from PubChem (CID 103386257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).