C24H43NO — CID 10338645
(2E,4E,14Z)-N-(2-methylpropyl)icosa-2,4,14-trienamide (PubChem CID 10338645) has the molecular formula C24H43NO and a molecular weight of 361.61 g/mol. Its IUPAC name is (2E,4E,14Z)-N-(2-methylpropyl)icosa-2,4,14-trienamide.
| Compound Name | (2E,4E,14Z)-N-(2-methylpropyl)icosa-2,4,14-trienamide |
|---|---|
| PubChem CID | 10338645 |
| Molecular Formula | C24H43NO |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.33 |
| IUPAC Name | (2E,4E,14Z)-N-(2-methylpropyl)icosa-2,4,14-trienamide |
| SMILES | CCCCC/C=C\CCCCCCCC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C24H43NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(26)25-22-23(2)3/h8-9,18-21,23H,4-7,10-17,22H2,1-3H3,(H,25,26)/b9-8-,19-18+,21-20+ |
| InChIKey | GQCWFFNZERNJJC-SEXMCKGYSA-N |
| XLogP | 7.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|