About [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine
[5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine (PubChem CID 103386689) has the molecular formula C12H17N3S
and a molecular weight of 235.36 g/mol. Its IUPAC name is [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine |
| PubChem CID | 103386689 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine |
| SMILES | CCc1nc(-c2cc(CN)cs2)[nH]c1CC |
| InChI | InChI=1S/C12H17N3S/c1-3-9-10(4-2)15-12(14-9)11-5-8(6-13)7-16-11/h5,7H,3-4,6,13H2,1-2H3,(H,14,15) |
| InChIKey | CPCVSJXAZBOUFK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine?
The IUPAC name of [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine (CID 103386689) is [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine.
What is the SMILES notation for [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine?
The canonical SMILES for [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine is CCc1nc(-c2cc(CN)cs2)[nH]c1CC.
What is the InChIKey of [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine?
The InChIKey is CPCVSJXAZBOUFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3S/c1-3-9-10(4-2)15-12(14-9)11-5-8(6-13)7-16-11/h5,7H,3-4,6,13H2,1-2H3,(H,14,15).
What are the key properties of [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine?
[5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine has a molecular weight of 235.36 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4,5-diethyl-1H-imidazol-2-yl)thiophen-3-yl]methanamine is sourced from PubChem (CID 103386689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).