C16H22N6O2S — CID 10338695
N-cyclohexyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide (PubChem CID 10338695) has the molecular formula C16H22N6O2S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-cyclohexyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide.
| Compound Name | N-cyclohexyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide |
|---|---|
| PubChem CID | 10338695 |
| Molecular Formula | C16H22N6O2S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-cyclohexyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide |
| SMILES | CSc1nc2nc3c(c(=O)n2[nH]1)CN(C(=O)NC1CCCCC1)CC3 |
| InChI | InChI=1S/C16H22N6O2S/c1-25-15-19-14-18-12-7-8-21(9-11(12)13(23)22(14)20-15)16(24)17-10-5-3-2-4-6-10/h10H,2-9H2,1H3,(H,17,24)(H,18,19,20) |
| InChIKey | YIXURNRUSRUPKJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |