C20H17N3O4 — CID 10338734
15-[2-(dimethylamino)ethyl]-3-nitro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione (PubChem CID 10338734) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-3-nitro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione.
| Compound Name | 15-[2-(dimethylamino)ethyl]-3-nitro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione |
|---|---|
| PubChem CID | 10338734 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-3-nitro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc4cccc([N+](=O)[O-])c4c(c23)C1=O |
| InChI | InChI=1S/C20H17N3O4/c1-21(2)9-10-22-19(24)14-7-3-5-12-11-13-6-4-8-15(23(26)27)17(13)18(16(12)14)20(22)25/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | QKANXVQSRQMWOM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|