C9H18N4O — CID 103387849
5-methoxy-4-N-(1H-pyrazol-4-yl)pentane-1,4-diamine (PubChem CID 103387849) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-methoxy-4-N-(1H-pyrazol-4-yl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(1H-pyrazol-4-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 103387849 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 5-methoxy-4-N-(1H-pyrazol-4-yl)pentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1cn[nH]c1 |
| InChI | InChI=1S/C9H18N4O/c1-14-7-8(3-2-4-10)13-9-5-11-12-6-9/h5-6,8,13H,2-4,7,10H2,1H3,(H,11,12) |
| InChIKey | WRZUJPXAGQMQIG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |