About 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide
2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide (PubChem CID 10338840) has the molecular formula C15H13F2N5O4
and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide |
| PubChem CID | 10338840 |
| Molecular Formula | C15H13F2N5O4 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide |
| SMILES | COC(Cn1c(-c2cc(F)cc(F)c2)ncc(C(=O)N=[N+]=[N-])c1=O)OC |
| InChI | InChI=1S/C15H13F2N5O4/c1-25-12(26-2)7-22-13(8-3-9(16)5-10(17)4-8)19-6-11(15(22)24)14(23)20-21-18/h3-6,12H,7H2,1-2H3 |
| InChIKey | RCTJQAPJWUQXBK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 119.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide?
The IUPAC name of 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide (CID 10338840) is 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide.
What is the SMILES notation for 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide?
The canonical SMILES for 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide is COC(Cn1c(-c2cc(F)cc(F)c2)ncc(C(=O)N=[N+]=[N-])c1=O)OC.
What is the InChIKey of 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide?
The InChIKey is RCTJQAPJWUQXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N5O4/c1-25-12(26-2)7-22-13(8-3-9(16)5-10(17)4-8)19-6-11(15(22)24)14(23)20-21-18/h3-6,12H,7H2,1-2H3.
What are the key properties of 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide?
2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide has a molecular weight of 365.30 g/mol, XLogP of 2.26, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carbonyl azide is sourced from PubChem (CID 10338840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).