C14H23N3O3 — CID 103389472
5-methoxy-4-N-[2-(4-nitrophenyl)ethyl]pentane-1,4-diamine (PubChem CID 103389472) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-methoxy-4-N-[2-(4-nitrophenyl)ethyl]pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-[2-(4-nitrophenyl)ethyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 103389472 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 5-methoxy-4-N-[2-(4-nitrophenyl)ethyl]pentane-1,4-diamine |
| SMILES | COCC(CCCN)NCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H23N3O3/c1-20-11-13(3-2-9-15)16-10-8-12-4-6-14(7-5-12)17(18)19/h4-7,13,16H,2-3,8-11,15H2,1H3 |
| InChIKey | JGACSFGVFQPJNW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|